C21H31N5O4S — CID 23070735
tert-butyl 4-[1-but-2-ynyl-5-ethoxycarbonyl-4-(C-methylsulfanylcarbonimidoyl)imidazol-2-yl]piperazine-1-carboxylate (PubChem CID 23070735) has the molecular formula C21H31N5O4S and a molecular weight of 449.58 g/mol. Its IUPAC name is tert-butyl 4-[1-but-2-ynyl-5-ethoxycarbonyl-4-(C-methylsulfanylcarbonimidoyl)imidazol-2-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-but-2-ynyl-5-ethoxycarbonyl-4-(C-methylsulfanylcarbonimidoyl)imidazol-2-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 23070735 |
| Molecular Formula | C21H31N5O4S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | tert-butyl 4-[1-but-2-ynyl-5-ethoxycarbonyl-4-(C-methylsulfanylcarbonimidoyl)imidazol-2-yl]piperazine-1-carboxylate |
| SMILES | [H]/N=C(\SC)c1nc(N2CCN(C(=O)OC(C)(C)C)CC2)n(CC#CC)c1C(=O)OCC |
| InChI | InChI=1S/C21H31N5O4S/c1-7-9-10-26-16(18(27)29-8-2)15(17(22)31-6)23-19(26)24-11-13-25(14-12-24)20(28)30-21(3,4)5/h22H,8,10-14H2,1-6H3/b22-17- |
| InChIKey | MWMFSWHXCLYDKX-XLNRJJMWSA-N |
| XLogP | 2.83 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|