C18H24N6O3 — CID 21098100
tert-butyl 4-(1-but-2-ynyl-7-oxo-6H-imidazo[4,5-d]pyridazin-2-yl)piperazine-1-carboxylate (PubChem CID 21098100) has the molecular formula C18H24N6O3 and a molecular weight of 372.43 g/mol. Its IUPAC name is tert-butyl 4-(1-but-2-ynyl-7-oxo-6H-imidazo[4,5-d]pyridazin-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-but-2-ynyl-7-oxo-6H-imidazo[4,5-d]pyridazin-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 21098100 |
| Molecular Formula | C18H24N6O3 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | tert-butyl 4-(1-but-2-ynyl-7-oxo-6H-imidazo[4,5-d]pyridazin-2-yl)piperazine-1-carboxylate |
| SMILES | CC#CCn1c(N2CCN(C(=O)OC(C)(C)C)CC2)nc2cn[nH]c(=O)c21 |
| InChI | InChI=1S/C18H24N6O3/c1-5-6-7-24-14-13(12-19-21-15(14)25)20-16(24)22-8-10-23(11-9-22)17(26)27-18(2,3)4/h12H,7-11H2,1-4H3,(H,21,25) |
| InChIKey | NEGZVXFDJSNCKD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|