C20H27N5O6 — CID 59424163
tert-butyl 4-(1-but-2-ynyl-5-methoxycarbonyl-4-oxamoylimidazol-2-yl)piperazine-1-carboxylate (PubChem CID 59424163) has the molecular formula C20H27N5O6 and a molecular weight of 433.47 g/mol. Its IUPAC name is tert-butyl 4-(1-but-2-ynyl-5-methoxycarbonyl-4-oxamoylimidazol-2-yl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(1-but-2-ynyl-5-methoxycarbonyl-4-oxamoylimidazol-2-yl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 59424163 |
| Molecular Formula | C20H27N5O6 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | tert-butyl 4-(1-but-2-ynyl-5-methoxycarbonyl-4-oxamoylimidazol-2-yl)piperazine-1-carboxylate |
| SMILES | CC#CCn1c(N2CCN(C(=O)OC(C)(C)C)CC2)nc(C(=O)C(N)=O)c1C(=O)OC |
| InChI | InChI=1S/C20H27N5O6/c1-6-7-8-25-14(17(28)30-5)13(15(26)16(21)27)22-18(25)23-9-11-24(12-10-23)19(29)31-20(2,3)4/h8-12H2,1-5H3,(H2,21,27) |
| InChIKey | JIBDQCRQUOTIJL-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 137.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|