C14H23N3 — CID 23071599
5-(4-methylpiperazin-1-yl)-5-[(E)-prop-1-enyl]cyclohexa-1,3-dien-1-amine (PubChem CID 23071599) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 5-(4-methylpiperazin-1-yl)-5-[(E)-prop-1-enyl]cyclohexa-1,3-dien-1-amine.
| Compound Name | 5-(4-methylpiperazin-1-yl)-5-[(E)-prop-1-enyl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 23071599 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 5-(4-methylpiperazin-1-yl)-5-[(E)-prop-1-enyl]cyclohexa-1,3-dien-1-amine |
| SMILES | C/C=C/C1(N2CCN(C)CC2)C=CC=C(N)C1 |
| InChI | InChI=1S/C14H23N3/c1-3-6-14(7-4-5-13(15)12-14)17-10-8-16(2)9-11-17/h3-7H,8-12,15H2,1-2H3/b6-3+ |
| InChIKey | MWEPBSKDHLVGCO-ZZXKWVIFSA-N |
| XLogP | 1.35 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|