C22H39N5 — CID 23086379
4-(azepan-1-yl)-N-[1-(2-ethylhexyl)pyrrolidin-3-yl]pyrimidin-2-amine (PubChem CID 23086379) has the molecular formula C22H39N5 and a molecular weight of 373.59 g/mol. Its IUPAC name is 4-(azepan-1-yl)-N-[1-(2-ethylhexyl)pyrrolidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(azepan-1-yl)-N-[1-(2-ethylhexyl)pyrrolidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 23086379 |
| Molecular Formula | C22H39N5 |
| Molecular Weight | 373.59 g/mol |
| Exact Mass | 373.32 |
| IUPAC Name | 4-(azepan-1-yl)-N-[1-(2-ethylhexyl)pyrrolidin-3-yl]pyrimidin-2-amine |
| SMILES | CCCCC(CC)CN1CCC(Nc2nccc(N3CCCCCC3)n2)C1 |
| InChI | InChI=1S/C22H39N5/c1-3-5-10-19(4-2)17-26-16-12-20(18-26)24-22-23-13-11-21(25-22)27-14-8-6-7-9-15-27/h11,13,19-20H,3-10,12,14-18H2,1-2H3,(H,23,24,25) |
| InChIKey | VUUPXUMGOOACTA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |