C23H41N5 — CID 66903224
N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-heptan-2-ylazepan-3-amine (PubChem CID 66903224) has the molecular formula C23H41N5 and a molecular weight of 387.62 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-heptan-2-ylazepan-3-amine.
| Compound Name | N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-heptan-2-ylazepan-3-amine |
|---|---|
| PubChem CID | 66903224 |
| Molecular Formula | C23H41N5 |
| Molecular Weight | 387.62 g/mol |
| Exact Mass | 387.34 |
| IUPAC Name | N-[4-(azepan-1-yl)pyrimidin-2-yl]-1-heptan-2-ylazepan-3-amine |
| SMILES | CCCCCC(C)N1CCCCC(Nc2nccc(N3CCCCCC3)n2)C1 |
| InChI | InChI=1S/C23H41N5/c1-3-4-7-12-20(2)28-18-11-8-13-21(19-28)25-23-24-15-14-22(26-23)27-16-9-5-6-10-17-27/h14-15,20-21H,3-13,16-19H2,1-2H3,(H,24,25,26) |
| InChIKey | PXTDUCMLAZPWJL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.62 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|