C10H10F6N2O2 — CID 23092433
6-methyl-2,4-bis(2,2,2-trifluoroethoxy)pyridin-3-amine (PubChem CID 23092433) has the molecular formula C10H10F6N2O2 and a molecular weight of 304.19 g/mol. Its IUPAC name is 6-methyl-2,4-bis(2,2,2-trifluoroethoxy)pyridin-3-amine.
| Compound Name | 6-methyl-2,4-bis(2,2,2-trifluoroethoxy)pyridin-3-amine |
|---|---|
| PubChem CID | 23092433 |
| Molecular Formula | C10H10F6N2O2 |
| Molecular Weight | 304.19 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 6-methyl-2,4-bis(2,2,2-trifluoroethoxy)pyridin-3-amine |
| SMILES | Cc1cc(OCC(F)(F)F)c(N)c(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C10H10F6N2O2/c1-5-2-6(19-3-9(11,12)13)7(17)8(18-5)20-4-10(14,15)16/h2H,3-4,17H2,1H3 |
| InChIKey | UAHLAAUQRDAUNG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |