About propyl dodecanoate;2-(trimethylazaniumyl)acetate
propyl dodecanoate;2-(trimethylazaniumyl)acetate (PubChem CID 23093438) has the molecular formula C20H41NO4
and a molecular weight of 359.55 g/mol. Its IUPAC name is propyl dodecanoate;2-(trimethylazaniumyl)acetate.
Molecular Properties
| Compound Name | propyl dodecanoate;2-(trimethylazaniumyl)acetate |
| PubChem CID | 23093438 |
| Molecular Formula | C20H41NO4 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.30 |
| IUPAC Name | propyl dodecanoate;2-(trimethylazaniumyl)acetate |
| SMILES | CCCCCCCCCCCC(=O)OCCC.C[N+](C)(C)CC(=O)[O-] |
| InChI | InChI=1S/C15H30O2.C5H11NO2/c1-3-5-6-7-8-9-10-11-12-13-15(16)17-14-4-2;1-6(2,3)4-5(7)8/h3-14H2,1-2H3;4H2,1-3H3 |
| InChIKey | HWIOERKKUMRCEW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze propyl dodecanoate;2-(trimethylazaniumyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl dodecanoate;2-(trimethylazaniumyl)acetate?
The IUPAC name of propyl dodecanoate;2-(trimethylazaniumyl)acetate (CID 23093438) is propyl dodecanoate;2-(trimethylazaniumyl)acetate.
What is the SMILES notation for propyl dodecanoate;2-(trimethylazaniumyl)acetate?
The canonical SMILES for propyl dodecanoate;2-(trimethylazaniumyl)acetate is CCCCCCCCCCCC(=O)OCCC.C[N+](C)(C)CC(=O)[O-].
What is the InChIKey of propyl dodecanoate;2-(trimethylazaniumyl)acetate?
The InChIKey is HWIOERKKUMRCEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2.C5H11NO2/c1-3-5-6-7-8-9-10-11-12-13-15(16)17-14-4-2;1-6(2,3)4-5(7)8/h3-14H2,1-2H3;4H2,1-3H3.
What are the key properties of propyl dodecanoate;2-(trimethylazaniumyl)acetate?
propyl dodecanoate;2-(trimethylazaniumyl)acetate has a molecular weight of 359.55 g/mol, XLogP of 3.30, 14 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propyl dodecanoate;2-(trimethylazaniumyl)acetate is sourced from PubChem (CID 23093438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).