C22H15BrN4O3 — CID 2309554
(E)-N-(2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-3-(4-nitrophenyl)prop-2-enamide (PubChem CID 2309554) has the molecular formula C22H15BrN4O3 and a molecular weight of 463.29 g/mol. Its IUPAC name is (E)-N-(2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-3-(4-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2309554 |
| Molecular Formula | C22H15BrN4O3 |
| Molecular Weight | 463.29 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | (E)-N-(2-bromo-11H-pyrido[1,2-b][2,4]benzodiazepin-6-ylidene)-3-(4-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)/N=C1\N=C2C=CC(Br)=CN2Cc2ccccc21 |
| InChI | InChI=1S/C22H15BrN4O3/c23-17-8-11-20-24-22(19-4-2-1-3-16(19)13-26(20)14-17)25-21(28)12-7-15-5-9-18(10-6-15)27(29)30/h1-12,14H,13H2/b12-7+,25-22- |
| InChIKey | QMSWDFYGWNFFHS-SQKRQBDJSA-N |
| XLogP | 4.60 |
| TPSA | 88.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.29 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|