About [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate
[1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate (PubChem CID 23105910) has the molecular formula C25H44O6
and a molecular weight of 440.62 g/mol. Its IUPAC name is [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate.
Molecular Properties
| Compound Name | [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate |
| PubChem CID | 23105910 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate |
| SMILES | CC1CCC(C(C)C)C(C(C)C(OC(=O)O)(OC(=O)O)C2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C25H44O6/c1-14(2)19-10-8-16(5)12-21(19)18(7)25(30-23(26)27,31-24(28)29)22-13-17(6)9-11-20(22)15(3)4/h14-22H,8-13H2,1-7H3,(H,26,27)(H,28,29) |
| InChIKey | MHFXIHLLQNYKTK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate?
The IUPAC name of [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate (CID 23105910) is [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate.
What is the SMILES notation for [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate?
The canonical SMILES for [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate is CC1CCC(C(C)C)C(C(C)C(OC(=O)O)(OC(=O)O)C2CC(C)CCC2C(C)C)C1.
What is the InChIKey of [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate?
The InChIKey is MHFXIHLLQNYKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H44O6/c1-14(2)19-10-8-16(5)12-21(19)18(7)25(30-23(26)27,31-24(28)29)22-13-17(6)9-11-20(22)15(3)4/h14-22H,8-13H2,1-7H3,(H,26,27)(H,28,29).
What are the key properties of [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate?
[1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate has a molecular weight of 440.62 g/mol, XLogP of 7.12, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate is sourced from PubChem (CID 23105910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).