C25H44O6 — CID 23105910
[1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate (PubChem CID 23105910) has the molecular formula C25H44O6 and a molecular weight of 440.62 g/mol. Its IUPAC name is [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate.
| Compound Name | [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate |
|---|---|
| PubChem CID | 23105910 |
| Molecular Formula | C25H44O6 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | [1-carboxyoxy-1,2-bis(5-methyl-2-propan-2-ylcyclohexyl)propyl] hydrogen carbonate |
| SMILES | CC1CCC(C(C)C)C(C(C)C(OC(=O)O)(OC(=O)O)C2CC(C)CCC2C(C)C)C1 |
| InChI | InChI=1S/C25H44O6/c1-14(2)19-10-8-16(5)12-21(19)18(7)25(30-23(26)27,31-24(28)29)22-13-17(6)9-11-20(22)15(3)4/h14-22H,8-13H2,1-7H3,(H,26,27)(H,28,29) |
| InChIKey | MHFXIHLLQNYKTK-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|