C23H21ClN4O4 — CID 23108097
N-[4-chloro-2-[[(E)-(6-methyl-2-pyridinyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide (PubChem CID 23108097) has the molecular formula C23H21ClN4O4 and a molecular weight of 452.90 g/mol. Its IUPAC name is N-[4-chloro-2-[[(E)-(6-methyl-2-pyridinyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-chloro-2-[[(E)-(6-methyl-2-pyridinyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 23108097 |
| Molecular Formula | C23H21ClN4O4 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | N-[4-chloro-2-[[(E)-(6-methyl-2-pyridinyl)methylideneamino]carbamoyl]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)N/N=C/c2cccc(C)n2)cc1OC |
| InChI | InChI=1S/C23H21ClN4O4/c1-14-5-4-6-17(26-14)13-25-28-23(30)18-12-16(24)8-9-19(18)27-22(29)15-7-10-20(31-2)21(11-15)32-3/h4-13H,1-3H3,(H,27,29)(H,28,30)/b25-13+ |
| InChIKey | LQDJGHMCFFJCDW-DHRITJCHSA-N |
| XLogP | 4.08 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|