C20H23ClN2O5 — CID 3608171
N-[4-chloro-2-(4-hydroxybutylcarbamoyl)phenyl]-3,4-dimethoxybenzamide (PubChem CID 3608171) has the molecular formula C20H23ClN2O5 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-[4-chloro-2-(4-hydroxybutylcarbamoyl)phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-chloro-2-(4-hydroxybutylcarbamoyl)phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 3608171 |
| Molecular Formula | C20H23ClN2O5 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N-[4-chloro-2-(4-hydroxybutylcarbamoyl)phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Cl)cc2C(=O)NCCCCO)cc1OC |
| InChI | InChI=1S/C20H23ClN2O5/c1-27-17-8-5-13(11-18(17)28-2)19(25)23-16-7-6-14(21)12-15(16)20(26)22-9-3-4-10-24/h5-8,11-12,24H,3-4,9-10H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | UOZSODUPCUSCOG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|