C16H10N2Na2O3 — CID 23110850
disodium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate (PubChem CID 23110850) has the molecular formula C16H10N2Na2O3 and a molecular weight of 324.25 g/mol. Its IUPAC name is disodium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate.
| Compound Name | disodium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate |
|---|---|
| PubChem CID | 23110850 |
| Molecular Formula | C16H10N2Na2O3 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | disodium;6-oxo-5,5-diphenylpyrimidine-2,4-diolate |
| SMILES | O=C1N=C([O-])N=C([O-])C1(c1ccccc1)c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C16H12N2O3.2Na/c19-13-16(11-7-3-1-4-8-11,12-9-5-2-6-10-12)14(20)18-15(21)17-13;;/h1-10H,(H2,17,18,19,20,21);;/q;2*+1/p-2 |
| InChIKey | FXLQHJXENWYOKM-UHFFFAOYSA-L |
| XLogP | -6.00 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | -6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |