About pyridin-2-ylmethanimine;rhenium
pyridin-2-ylmethanimine;rhenium (PubChem CID 23118324) has the molecular formula C6H5N2Re-
and a molecular weight of 291.33 g/mol. Its IUPAC name is pyridin-2-ylmethanimine;rhenium.
Molecular Properties
| Compound Name | pyridin-2-ylmethanimine;rhenium |
| PubChem CID | 23118324 |
| Molecular Formula | C6H5N2Re- |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | pyridin-2-ylmethanimine;rhenium |
| SMILES | [H]/N=[C-]/c1ccccn1.[Re] |
| InChI | InChI=1S/C6H5N2.Re/c7-5-6-3-1-2-4-8-6;/h1-4,7H;/q-1; |
| InChIKey | ITOQAWCHIQFFDR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-ylmethanimine;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-ylmethanimine;rhenium?
The IUPAC name of pyridin-2-ylmethanimine;rhenium (CID 23118324) is pyridin-2-ylmethanimine;rhenium.
What is the SMILES notation for pyridin-2-ylmethanimine;rhenium?
The canonical SMILES for pyridin-2-ylmethanimine;rhenium is [H]/N=[C-]/c1ccccn1.[Re].
What is the InChIKey of pyridin-2-ylmethanimine;rhenium?
The InChIKey is ITOQAWCHIQFFDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N2.Re/c7-5-6-3-1-2-4-8-6;/h1-4,7H;/q-1;.
What are the key properties of pyridin-2-ylmethanimine;rhenium?
pyridin-2-ylmethanimine;rhenium has a molecular weight of 291.33 g/mol, XLogP of 0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-ylmethanimine;rhenium is sourced from PubChem (CID 23118324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).