C23H27NO3 — CID 23121487
3-[[6-(3-phenylpropoxy)-3,4-dihydronaphthalen-2-yl]methylamino]propanoic acid (PubChem CID 23121487) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 3-[[6-(3-phenylpropoxy)-3,4-dihydronaphthalen-2-yl]methylamino]propanoic acid.
| Compound Name | 3-[[6-(3-phenylpropoxy)-3,4-dihydronaphthalen-2-yl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 23121487 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 3-[[6-(3-phenylpropoxy)-3,4-dihydronaphthalen-2-yl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCC1=Cc2ccc(OCCCc3ccccc3)cc2CC1 |
| InChI | InChI=1S/C23H27NO3/c25-23(26)12-13-24-17-19-8-9-21-16-22(11-10-20(21)15-19)27-14-4-7-18-5-2-1-3-6-18/h1-3,5-6,10-11,15-16,24H,4,7-9,12-14,17H2,(H,25,26) |
| InChIKey | POLDWVFGPMKYGL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|