C22H27Cl2NO3 — CID 66853331
3-[3-[2-chloro-4-(4-phenylbutoxy)phenyl]prop-2-enylamino]propanoic acid;hydrochloride (PubChem CID 66853331) has the molecular formula C22H27Cl2NO3 and a molecular weight of 424.37 g/mol. Its IUPAC name is 3-[3-[2-chloro-4-(4-phenylbutoxy)phenyl]prop-2-enylamino]propanoic acid;hydrochloride.
| Compound Name | 3-[3-[2-chloro-4-(4-phenylbutoxy)phenyl]prop-2-enylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66853331 |
| Molecular Formula | C22H27Cl2NO3 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 3-[3-[2-chloro-4-(4-phenylbutoxy)phenyl]prop-2-enylamino]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCNCC=Cc1ccc(OCCCCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C22H26ClNO3.ClH/c23-21-17-20(27-16-5-4-9-18-7-2-1-3-8-18)12-11-19(21)10-6-14-24-15-13-22(25)26;/h1-3,6-8,10-12,17,24H,4-5,9,13-16H2,(H,25,26);1H |
| InChIKey | WYRNLNBCZJQZGS-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|