C26H26ClNO3 — CID 23121218
3-[[(E)-3-[2-chloro-4-[2-(4-phenylphenyl)ethoxy]phenyl]prop-2-enyl]amino]propanoic acid (PubChem CID 23121218) has the molecular formula C26H26ClNO3 and a molecular weight of 435.95 g/mol. Its IUPAC name is 3-[[(E)-3-[2-chloro-4-[2-(4-phenylphenyl)ethoxy]phenyl]prop-2-enyl]amino]propanoic acid.
| Compound Name | 3-[[(E)-3-[2-chloro-4-[2-(4-phenylphenyl)ethoxy]phenyl]prop-2-enyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23121218 |
| Molecular Formula | C26H26ClNO3 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-[[(E)-3-[2-chloro-4-[2-(4-phenylphenyl)ethoxy]phenyl]prop-2-enyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC/C=C/c1ccc(OCCc2ccc(-c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C26H26ClNO3/c27-25-19-24(13-12-23(25)7-4-16-28-17-14-26(29)30)31-18-15-20-8-10-22(11-9-20)21-5-2-1-3-6-21/h1-13,19,28H,14-18H2,(H,29,30)/b7-4+ |
| InChIKey | CJCOTXSTXHCQCX-QPJJXVBHSA-N |
| XLogP | 5.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|