C24H31Cl2NO3 — CID 66853227
3-[[(E)-3-[2-chloro-4-[(4-pentylphenyl)methoxy]phenyl]prop-2-enyl]amino]propanoic acid;hydrochloride (PubChem CID 66853227) has the molecular formula C24H31Cl2NO3 and a molecular weight of 452.42 g/mol. Its IUPAC name is 3-[[(E)-3-[2-chloro-4-[(4-pentylphenyl)methoxy]phenyl]prop-2-enyl]amino]propanoic acid;hydrochloride.
| Compound Name | 3-[[(E)-3-[2-chloro-4-[(4-pentylphenyl)methoxy]phenyl]prop-2-enyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66853227 |
| Molecular Formula | C24H31Cl2NO3 |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3-[[(E)-3-[2-chloro-4-[(4-pentylphenyl)methoxy]phenyl]prop-2-enyl]amino]propanoic acid;hydrochloride |
| SMILES | CCCCCc1ccc(COc2ccc(/C=C/CNCCC(=O)O)c(Cl)c2)cc1.Cl |
| InChI | InChI=1S/C24H30ClNO3.ClH/c1-2-3-4-6-19-8-10-20(11-9-19)18-29-22-13-12-21(23(25)17-22)7-5-15-26-16-14-24(27)28;/h5,7-13,17,26H,2-4,6,14-16,18H2,1H3,(H,27,28);1H/b7-5+; |
| InChIKey | AMGCNOGJIKAJFR-GZOLSCHFSA-N |
| XLogP | 6.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|