C25H30ClNO3 — CID 66852913
3-[3-[2-chloro-4-[(4-cyclohexylphenyl)methoxy]phenyl]prop-2-enylamino]propanoic acid (PubChem CID 66852913) has the molecular formula C25H30ClNO3 and a molecular weight of 427.97 g/mol. Its IUPAC name is 3-[3-[2-chloro-4-[(4-cyclohexylphenyl)methoxy]phenyl]prop-2-enylamino]propanoic acid.
| Compound Name | 3-[3-[2-chloro-4-[(4-cyclohexylphenyl)methoxy]phenyl]prop-2-enylamino]propanoic acid |
|---|---|
| PubChem CID | 66852913 |
| Molecular Formula | C25H30ClNO3 |
| Molecular Weight | 427.97 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-[3-[2-chloro-4-[(4-cyclohexylphenyl)methoxy]phenyl]prop-2-enylamino]propanoic acid |
| SMILES | O=C(O)CCNCC=Cc1ccc(OCc2ccc(C3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C25H30ClNO3/c26-24-17-23(13-12-22(24)7-4-15-27-16-14-25(28)29)30-18-19-8-10-21(11-9-19)20-5-2-1-3-6-20/h4,7-13,17,20,27H,1-3,5-6,14-16,18H2,(H,28,29) |
| InChIKey | OSXQMYCTDVKYOB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.97 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|