C24H31NO3 — CID 23121299
3-[[(Z)-3-[4-(5-phenylpentoxy)phenyl]but-2-enyl]amino]propanoic acid (PubChem CID 23121299) has the molecular formula C24H31NO3 and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-[[(Z)-3-[4-(5-phenylpentoxy)phenyl]but-2-enyl]amino]propanoic acid.
| Compound Name | 3-[[(Z)-3-[4-(5-phenylpentoxy)phenyl]but-2-enyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23121299 |
| Molecular Formula | C24H31NO3 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 3-[[(Z)-3-[4-(5-phenylpentoxy)phenyl]but-2-enyl]amino]propanoic acid |
| SMILES | C/C(=C/CNCCC(=O)O)c1ccc(OCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H31NO3/c1-20(15-17-25-18-16-24(26)27)22-11-13-23(14-12-22)28-19-7-3-6-10-21-8-4-2-5-9-21/h2,4-5,8-9,11-15,25H,3,6-7,10,16-19H2,1H3,(H,26,27)/b20-15- |
| InChIKey | HTHAHYGRKLNVRX-HKWRFOASSA-N |
| XLogP | 4.95 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|