C15H13BF4N2 — CID 23126920
2,3-diphenyl-1H-imidazol-3-ium tetrafluoroborate (PubChem CID 23126920) has the molecular formula C15H13BF4N2 and a molecular weight of 308.09 g/mol. Its IUPAC name is 2,3-diphenyl-1H-imidazol-3-ium tetrafluoroborate.
| Compound Name | 2,3-diphenyl-1H-imidazol-3-ium tetrafluoroborate |
|---|---|
| PubChem CID | 23126920 |
| Molecular Formula | C15H13BF4N2 |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2,3-diphenyl-1H-imidazol-3-ium tetrafluoroborate |
| SMILES | F[B-](F)(F)F.c1ccc(-c2[nH]cc[n+]2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H12N2.BF4/c1-3-7-13(8-4-1)15-16-11-12-17(15)14-9-5-2-6-10-14;2-1(3,4)5/h1-12H;/q;-1/p+1 |
| InChIKey | BFQOMDZOYMNDKJ-UHFFFAOYSA-O |
| XLogP | 4.26 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|