About 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium
3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium (PubChem CID 140866251) has the molecular formula C21H25N2+
and a molecular weight of 305.44 g/mol. Its IUPAC name is 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium |
| PubChem CID | 140866251 |
| Molecular Formula | C21H25N2+ |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium |
| SMILES | CC(C)c1cccc(C(C)C)c1-[n+]1cc[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C21H24N2/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17/h5-16H,1-4H3/p+1 |
| InChIKey | DGCQHTACQZUATF-UHFFFAOYSA-O |
| XLogP | 5.21 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium?
The IUPAC name of 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium (CID 140866251) is 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium.
What is the SMILES notation for 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium?
The canonical SMILES for 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium is CC(C)c1cccc(C(C)C)c1-[n+]1cc[nH]c1-c1ccccc1.
What is the InChIKey of 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium?
The InChIKey is DGCQHTACQZUATF-UHFFFAOYSA-O. The full InChI is InChI=1S/C21H24N2/c1-15(2)18-11-8-12-19(16(3)4)20(18)23-14-13-22-21(23)17-9-6-5-7-10-17/h5-16H,1-4H3/p+1.
What are the key properties of 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium?
3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium has a molecular weight of 305.44 g/mol, XLogP of 5.21, 4 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-di(propan-2-yl)phenyl]-2-phenyl-1H-imidazol-3-ium is sourced from PubChem (CID 140866251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).