C15H24 — CID 23132013
4-cyclohexyltricyclo[4.2.1.03,7]nonane (PubChem CID 23132013) has the molecular formula C15H24 and a molecular weight of 204.36 g/mol. Its IUPAC name is 4-cyclohexyltricyclo[4.2.1.03,7]nonane.
| Compound Name | 4-cyclohexyltricyclo[4.2.1.03,7]nonane |
|---|---|
| PubChem CID | 23132013 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.19 |
| IUPAC Name | 4-cyclohexyltricyclo[4.2.1.03,7]nonane |
| SMILES | C1CCC(C2CC3CC4CC3C2C4)CC1 |
| InChI | InChI=1S/C15H24/c1-2-4-11(5-3-1)14-9-12-6-10-7-13(12)15(14)8-10/h10-15H,1-9H2 |
| InChIKey | OJAYRVGUMCVGJP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |