C18H19O5- — CID 23134391
2-[4-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]phenoxy]acetate (PubChem CID 23134391) has the molecular formula C18H19O5- and a molecular weight of 315.35 g/mol. Its IUPAC name is 2-[4-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]phenoxy]acetate.
| Compound Name | 2-[4-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]phenoxy]acetate |
|---|---|
| PubChem CID | 23134391 |
| Molecular Formula | C18H19O5- |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[4-[4-(2-hydroxyethoxy)-3,5-dimethylphenyl]phenoxy]acetate |
| SMILES | Cc1cc(-c2ccc(OCC(=O)[O-])cc2)cc(C)c1OCCO |
| InChI | InChI=1S/C18H20O5/c1-12-9-15(10-13(2)18(12)22-8-7-19)14-3-5-16(6-4-14)23-11-17(20)21/h3-6,9-10,19H,7-8,11H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | FDFMAISEBMPSRI-UHFFFAOYSA-M |
| XLogP | 1.47 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |