C45H58N2O4 — CID 23140904
N,N'-bis(2-benzyl-2-hydroxy-4,4-dimethyl-1-phenylpentan-3-yl)-2,2-dimethylpropanediamide (PubChem CID 23140904) has the molecular formula C45H58N2O4 and a molecular weight of 690.97 g/mol. Its IUPAC name is N,N'-bis(2-benzyl-2-hydroxy-4,4-dimethyl-1-phenylpentan-3-yl)-2,2-dimethylpropanediamide.
| Compound Name | N,N'-bis(2-benzyl-2-hydroxy-4,4-dimethyl-1-phenylpentan-3-yl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 23140904 |
| Molecular Formula | C45H58N2O4 |
| Molecular Weight | 690.97 g/mol |
| Exact Mass | 690.44 |
| IUPAC Name | N,N'-bis(2-benzyl-2-hydroxy-4,4-dimethyl-1-phenylpentan-3-yl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NC(C(C)(C)C)C(O)(Cc1ccccc1)Cc1ccccc1)C(=O)NC(C(C)(C)C)C(O)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C45H58N2O4/c1-41(2,3)37(44(50,29-33-21-13-9-14-22-33)30-34-23-15-10-16-24-34)46-39(48)43(7,8)40(49)47-38(42(4,5)6)45(51,31-35-25-17-11-18-26-35)32-36-27-19-12-20-28-36/h9-28,37-38,50-51H,29-32H2,1-8H3,(H,46,48)(H,47,49) |
| InChIKey | JGJACGGYCWGALR-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.97 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|