C17H25NO — CID 23143013
2-(4,4-diethylcyclohexen-1-yl)-5-methoxyaniline (PubChem CID 23143013) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2-(4,4-diethylcyclohexen-1-yl)-5-methoxyaniline.
| Compound Name | 2-(4,4-diethylcyclohexen-1-yl)-5-methoxyaniline |
|---|---|
| PubChem CID | 23143013 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2-(4,4-diethylcyclohexen-1-yl)-5-methoxyaniline |
| SMILES | CCC1(CC)CC=C(c2ccc(OC)cc2N)CC1 |
| InChI | InChI=1S/C17H25NO/c1-4-17(5-2)10-8-13(9-11-17)15-7-6-14(19-3)12-16(15)18/h6-8,12H,4-5,9-11,18H2,1-3H3 |
| InChIKey | MDJNWNDZMRAXSV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|