C21H32N2O — CID 23142033
1-[2-(4,4-diethylcyclohexen-1-yl)-5-methoxyphenyl]piperazine (PubChem CID 23142033) has the molecular formula C21H32N2O and a molecular weight of 328.50 g/mol. Its IUPAC name is 1-[2-(4,4-diethylcyclohexen-1-yl)-5-methoxyphenyl]piperazine.
| Compound Name | 1-[2-(4,4-diethylcyclohexen-1-yl)-5-methoxyphenyl]piperazine |
|---|---|
| PubChem CID | 23142033 |
| Molecular Formula | C21H32N2O |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.25 |
| IUPAC Name | 1-[2-(4,4-diethylcyclohexen-1-yl)-5-methoxyphenyl]piperazine |
| SMILES | CCC1(CC)CC=C(c2ccc(OC)cc2N2CCNCC2)CC1 |
| InChI | InChI=1S/C21H32N2O/c1-4-21(5-2)10-8-17(9-11-21)19-7-6-18(24-3)16-20(19)23-14-12-22-13-15-23/h6-8,16,22H,4-5,9-15H2,1-3H3 |
| InChIKey | UYEROJGCNVKMJK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |