C14H23N2+ — CID 2314671
1-[3-(aziridin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium (PubChem CID 2314671) has the molecular formula C14H23N2+ and a molecular weight of 219.35 g/mol. Its IUPAC name is 1-[3-(aziridin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium.
| Compound Name | 1-[3-(aziridin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 2314671 |
| Molecular Formula | C14H23N2+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | 1-[3-(aziridin-1-yl)-5,5-dimethylcyclohex-2-en-1-ylidene]pyrrolidin-1-ium |
| SMILES | CC1(C)CC(N2CC2)=CC(=[N+]2CCCC2)C1 |
| InChI | InChI=1S/C14H23N2/c1-14(2)10-12(15-5-3-4-6-15)9-13(11-14)16-7-8-16/h9H,3-8,10-11H2,1-2H3/q+1 |
| InChIKey | LJZQTQCAJSTRKT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 6.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|