About 2-(4-fluorophenyl)acetyl isocyanate
2-(4-fluorophenyl)acetyl isocyanate (PubChem CID 23153088) has the molecular formula C9H6FNO2
and a molecular weight of 179.15 g/mol. Its IUPAC name is 2-(4-fluorophenyl)acetyl isocyanate.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)acetyl isocyanate |
| PubChem CID | 23153088 |
| Molecular Formula | C9H6FNO2 |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2-(4-fluorophenyl)acetyl isocyanate |
| SMILES | O=C=NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C9H6FNO2/c10-8-3-1-7(2-4-8)5-9(13)11-6-12/h1-4H,5H2 |
| InChIKey | UDZXXLPKRIAPKR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-fluorophenyl)acetyl isocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)acetyl isocyanate?
The IUPAC name of 2-(4-fluorophenyl)acetyl isocyanate (CID 23153088) is 2-(4-fluorophenyl)acetyl isocyanate.
What is the SMILES notation for 2-(4-fluorophenyl)acetyl isocyanate?
The canonical SMILES for 2-(4-fluorophenyl)acetyl isocyanate is O=C=NC(=O)Cc1ccc(F)cc1.
What is the InChIKey of 2-(4-fluorophenyl)acetyl isocyanate?
The InChIKey is UDZXXLPKRIAPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6FNO2/c10-8-3-1-7(2-4-8)5-9(13)11-6-12/h1-4H,5H2.
What are the key properties of 2-(4-fluorophenyl)acetyl isocyanate?
2-(4-fluorophenyl)acetyl isocyanate has a molecular weight of 179.15 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)acetyl isocyanate is sourced from PubChem (CID 23153088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).