About ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide
ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide (PubChem CID 143235198) has the molecular formula C19H22FN3O
and a molecular weight of 327.40 g/mol. Its IUPAC name is ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide.
Molecular Properties
| Compound Name | ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide |
| PubChem CID | 143235198 |
| Molecular Formula | C19H22FN3O |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide |
| SMILES | C=C.CCc1ccc(C)cc1.[N-]=[N+]=NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C9H12.C8H6FN3O.C2H4/c1-3-9-6-4-8(2)5-7-9;9-7-3-1-6(2-4-7)5-8(13)11-12-10;1-2/h4-7H,3H2,1-2H3;1-4H,5H2;1-2H2 |
| InChIKey | HCCNAMIEJGFCDO-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide?
The IUPAC name of ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide (CID 143235198) is ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide.
What is the SMILES notation for ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide?
The canonical SMILES for ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide is C=C.CCc1ccc(C)cc1.[N-]=[N+]=NC(=O)Cc1ccc(F)cc1.
What is the InChIKey of ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide?
The InChIKey is HCCNAMIEJGFCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C8H6FN3O.C2H4/c1-3-9-6-4-8(2)5-7-9;9-7-3-1-6(2-4-7)5-8(13)11-12-10;1-2/h4-7H,3H2,1-2H3;1-4H,5H2;1-2H2.
What are the key properties of ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide?
ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide has a molecular weight of 327.40 g/mol, XLogP of 5.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1-ethyl-4-methylbenzene;2-(4-fluorophenyl)acetyl azide is sourced from PubChem (CID 143235198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).