About 4-ethylbenzoyl azide
4-ethylbenzoyl azide (PubChem CID 43307154) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 4-ethylbenzoyl azide.
Molecular Properties
| Compound Name | 4-ethylbenzoyl azide |
| PubChem CID | 43307154 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 4-ethylbenzoyl azide |
| SMILES | CCc1ccc(C(=O)N=[N+]=[N-])cc1 |
| InChI | InChI=1S/C9H9N3O/c1-2-7-3-5-8(6-4-7)9(13)11-12-10/h3-6H,2H2,1H3 |
| InChIKey | ZHQVQFQLVNCHLJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylbenzoyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylbenzoyl azide?
The IUPAC name of 4-ethylbenzoyl azide (CID 43307154) is 4-ethylbenzoyl azide.
What is the SMILES notation for 4-ethylbenzoyl azide?
The canonical SMILES for 4-ethylbenzoyl azide is CCc1ccc(C(=O)N=[N+]=[N-])cc1.
What is the InChIKey of 4-ethylbenzoyl azide?
The InChIKey is ZHQVQFQLVNCHLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-2-7-3-5-8(6-4-7)9(13)11-12-10/h3-6H,2H2,1H3.
What are the key properties of 4-ethylbenzoyl azide?
4-ethylbenzoyl azide has a molecular weight of 175.19 g/mol, XLogP of 2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylbenzoyl azide is sourced from PubChem (CID 43307154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).