C25H27N3O3 — CID 23159946
3-[4-[[4-[(3-pyrazin-2-ylpyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 23159946) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is 3-[4-[[4-[(3-pyrazin-2-ylpyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[[4-[(3-pyrazin-2-ylpyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23159946 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | 3-[4-[[4-[(3-pyrazin-2-ylpyrrolidin-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OCc2ccc(CN3CCC(c4cnccn4)C3)cc2)cc1 |
| InChI | InChI=1S/C25H27N3O3/c29-25(30)10-7-19-5-8-23(9-6-19)31-18-21-3-1-20(2-4-21)16-28-14-11-22(17-28)24-15-26-12-13-27-24/h1-6,8-9,12-13,15,22H,7,10-11,14,16-18H2,(H,29,30) |
| InChIKey | RCNUHJBCTPTHOL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |