C27H27NO4 — CID 23159997
3-[4-[[4-[(5-methoxy-2-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 23159997) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 3-[4-[[4-[(5-methoxy-2-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[[4-[(5-methoxy-2-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23159997 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 3-[4-[[4-[(5-methoxy-2-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | COc1ccc2c(c1)cc(C)n2Cc1ccc(COc2ccc(CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-19-15-23-16-25(31-2)12-13-26(23)28(19)17-21-3-5-22(6-4-21)18-32-24-10-7-20(8-11-24)9-14-27(29)30/h3-8,10-13,15-16H,9,14,17-18H2,1-2H3,(H,29,30) |
| InChIKey | IJJGOPDKROKQQH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |