C32H29NO3 — CID 23159895
methyl 3-[4-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoate (PubChem CID 23159895) has the molecular formula C32H29NO3 and a molecular weight of 475.59 g/mol. Its IUPAC name is methyl 3-[4-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoate.
| Compound Name | methyl 3-[4-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 23159895 |
| Molecular Formula | C32H29NO3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | methyl 3-[4-[[4-[(2-phenylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(OCc2ccc(Cn3c(-c4ccccc4)cc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C32H29NO3/c1-35-32(34)20-17-24-15-18-29(19-16-24)36-23-26-13-11-25(12-14-26)22-33-30-10-6-5-9-28(30)21-31(33)27-7-3-2-4-8-27/h2-16,18-19,21H,17,20,22-23H2,1H3 |
| InChIKey | ZNWWGERZIIJPSR-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |