C26H25NO3 — CID 23159869
3-[4-[[4-[(7-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid (PubChem CID 23159869) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is 3-[4-[[4-[(7-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid.
| Compound Name | 3-[4-[[4-[(7-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 23159869 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | 3-[4-[[4-[(7-methylindol-1-yl)methyl]phenyl]methoxy]phenyl]propanoic acid |
| SMILES | Cc1cccc2ccn(Cc3ccc(COc4ccc(CCC(=O)O)cc4)cc3)c12 |
| InChI | InChI=1S/C26H25NO3/c1-19-3-2-4-23-15-16-27(26(19)23)17-21-5-7-22(8-6-21)18-30-24-12-9-20(10-13-24)11-14-25(28)29/h2-10,12-13,15-16H,11,14,17-18H2,1H3,(H,28,29) |
| InChIKey | ZPGJKSDNOVBTTH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |