C21H21N3O — CID 23174507
4-[(1-phenylpyrazol-3-yl)amino]-2,6-bis(prop-2-enyl)phenol (PubChem CID 23174507) has the molecular formula C21H21N3O and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-[(1-phenylpyrazol-3-yl)amino]-2,6-bis(prop-2-enyl)phenol.
| Compound Name | 4-[(1-phenylpyrazol-3-yl)amino]-2,6-bis(prop-2-enyl)phenol |
|---|---|
| PubChem CID | 23174507 |
| Molecular Formula | C21H21N3O |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 4-[(1-phenylpyrazol-3-yl)amino]-2,6-bis(prop-2-enyl)phenol |
| SMILES | C=CCc1cc(Nc2ccn(-c3ccccc3)n2)cc(CC=C)c1O |
| InChI | InChI=1S/C21H21N3O/c1-3-8-16-14-18(15-17(9-4-2)21(16)25)22-20-12-13-24(23-20)19-10-6-5-7-11-19/h3-7,10-15,25H,1-2,8-9H2,(H,22,23) |
| InChIKey | YHQZYXJWLJCPMF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|