C25H23N3O3 — CID 67792763
[2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]phenyl] methyl carbonate (PubChem CID 67792763) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is [2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]phenyl] methyl carbonate.
| Compound Name | [2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]phenyl] methyl carbonate |
|---|---|
| PubChem CID | 67792763 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | [2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]phenyl] methyl carbonate |
| SMILES | COC(=O)Oc1ccccc1-c1c(C)cc(Nc2ccn(-c3ccccc3)n2)cc1C |
| InChI | InChI=1S/C25H23N3O3/c1-17-15-19(26-23-13-14-28(27-23)20-9-5-4-6-10-20)16-18(2)24(17)21-11-7-8-12-22(21)31-25(29)30-3/h4-16H,1-3H3,(H,26,27) |
| InChIKey | GLANPEQZWZRYIM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|