C20H17N4O2- — CID 23174537
2-cyano-2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]acetate (PubChem CID 23174537) has the molecular formula C20H17N4O2- and a molecular weight of 345.38 g/mol. Its IUPAC name is 2-cyano-2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]acetate.
| Compound Name | 2-cyano-2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 23174537 |
| Molecular Formula | C20H17N4O2- |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-cyano-2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]acetate |
| SMILES | Cc1cc(Nc2ccn(-c3ccccc3)n2)cc(C)c1C(C#N)C(=O)[O-] |
| InChI | InChI=1S/C20H18N4O2/c1-13-10-15(11-14(2)19(13)17(12-21)20(25)26)22-18-8-9-24(23-18)16-6-4-3-5-7-16/h3-11,17H,1-2H3,(H,22,23)(H,25,26)/p-1 |
| InChIKey | GZFONCLRJYBOBM-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |