C21H23N3O2 — CID 23174493
2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]butanoic acid (PubChem CID 23174493) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]butanoic acid.
| Compound Name | 2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]butanoic acid |
|---|---|
| PubChem CID | 23174493 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 2-[2,6-dimethyl-4-[(1-phenylpyrazol-3-yl)amino]phenyl]butanoic acid |
| SMILES | CCC(C(=O)O)c1c(C)cc(Nc2ccn(-c3ccccc3)n2)cc1C |
| InChI | InChI=1S/C21H23N3O2/c1-4-18(21(25)26)20-14(2)12-16(13-15(20)3)22-19-10-11-24(23-19)17-8-6-5-7-9-17/h5-13,18H,4H2,1-3H3,(H,22,23)(H,25,26) |
| InChIKey | AAPNZBZTROABIE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |