C17H11ClF5N3O2S — CID 23209750
N-[5-(4-chlorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 23209750) has the molecular formula C17H11ClF5N3O2S and a molecular weight of 451.80 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | N-[5-(4-chlorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23209750 |
| Molecular Formula | C17H11ClF5N3O2S |
| Molecular Weight | 451.80 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | N-[5-(4-chlorophenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nn1nc(C(F)(F)C(F)(F)F)cc1-c1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H11ClF5N3O2S/c18-12-8-6-11(7-9-12)14-10-15(16(19,20)17(21,22)23)24-26(14)25-29(27,28)13-4-2-1-3-5-13/h1-10,25H |
| InChIKey | YYLRQSSTWMCGGY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.80 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|