C22H18ClN3O2S2 — CID 23215863
N-[5-(4-chlorophenyl)-3-(2-methylsulfanylphenyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 23215863) has the molecular formula C22H18ClN3O2S2 and a molecular weight of 455.99 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-3-(2-methylsulfanylphenyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | N-[5-(4-chlorophenyl)-3-(2-methylsulfanylphenyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23215863 |
| Molecular Formula | C22H18ClN3O2S2 |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | N-[5-(4-chlorophenyl)-3-(2-methylsulfanylphenyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | CSc1ccccc1-c1cc(-c2ccc(Cl)cc2)n(NS(=O)(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C22H18ClN3O2S2/c1-29-22-10-6-5-9-19(22)20-15-21(16-11-13-17(23)14-12-16)26(24-20)25-30(27,28)18-7-3-2-4-8-18/h2-15,25H,1H3 |
| InChIKey | QWMSKALQYHWACT-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |