C17H13ClF3N3O2S — CID 23209661
N-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 23209661) has the molecular formula C17H13ClF3N3O2S and a molecular weight of 415.82 g/mol. Its IUPAC name is N-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | N-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23209661 |
| Molecular Formula | C17H13ClF3N3O2S |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | N-[5-(4-chloro-3-methylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | Cc1cc(-c2cc(C(F)(F)F)nn2NS(=O)(=O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C17H13ClF3N3O2S/c1-11-9-12(7-8-14(11)18)15-10-16(17(19,20)21)22-24(15)23-27(25,26)13-5-3-2-4-6-13/h2-10,23H,1H3 |
| InChIKey | UJDJIXSRXWPFND-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |