C17H13F3N4O4S — CID 23209729
N-[5-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 23209729) has the molecular formula C17H13F3N4O4S and a molecular weight of 426.38 g/mol. Its IUPAC name is N-[5-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | N-[5-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23209729 |
| Molecular Formula | C17H13F3N4O4S |
| Molecular Weight | 426.38 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | N-[5-(4-methyl-3-nitrophenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2NS(=O)(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13F3N4O4S/c1-11-7-8-12(9-14(11)24(25)26)15-10-16(17(18,19)20)21-23(15)22-29(27,28)13-5-3-2-4-6-13/h2-10,22H,1H3 |
| InChIKey | FIBSQCPTQSNVNJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|