C20H16ClN3O2S2 — CID 67580508
N-[5-(4-chlorophenyl)-3-(4-methylthiophen-2-yl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 67580508) has the molecular formula C20H16ClN3O2S2 and a molecular weight of 429.95 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)-3-(4-methylthiophen-2-yl)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | N-[5-(4-chlorophenyl)-3-(4-methylthiophen-2-yl)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 67580508 |
| Molecular Formula | C20H16ClN3O2S2 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | N-[5-(4-chlorophenyl)-3-(4-methylthiophen-2-yl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | Cc1csc(-c2cc(-c3ccc(Cl)cc3)n(NS(=O)(=O)c3ccccc3)n2)c1 |
| InChI | InChI=1S/C20H16ClN3O2S2/c1-14-11-20(27-13-14)18-12-19(15-7-9-16(21)10-8-15)24(22-18)23-28(25,26)17-5-3-2-4-6-17/h2-13,23H,1H3 |
| InChIKey | SBUZXABJUVKKEF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |