C22H18Cl2N4O4S2 — CID 23215779
N-[3,5-bis(4-chlorophenyl)-4-(methanesulfonamido)pyrazol-1-yl]benzenesulfonamide (PubChem CID 23215779) has the molecular formula C22H18Cl2N4O4S2 and a molecular weight of 537.45 g/mol. Its IUPAC name is N-[3,5-bis(4-chlorophenyl)-4-(methanesulfonamido)pyrazol-1-yl]benzenesulfonamide.
| Compound Name | N-[3,5-bis(4-chlorophenyl)-4-(methanesulfonamido)pyrazol-1-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23215779 |
| Molecular Formula | C22H18Cl2N4O4S2 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | N-[3,5-bis(4-chlorophenyl)-4-(methanesulfonamido)pyrazol-1-yl]benzenesulfonamide |
| SMILES | CS(=O)(=O)Nc1c(-c2ccc(Cl)cc2)nn(NS(=O)(=O)c2ccccc2)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18Cl2N4O4S2/c1-33(29,30)26-21-20(15-7-11-17(23)12-8-15)25-28(22(21)16-9-13-18(24)14-10-16)27-34(31,32)19-5-3-2-4-6-19/h2-14,26-27H,1H3 |
| InChIKey | VCGINXVCMFNMBD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |