C11H7F5N2O — CID 23218982
2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-1H-imidazole (PubChem CID 23218982) has the molecular formula C11H7F5N2O and a molecular weight of 278.18 g/mol. Its IUPAC name is 2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-1H-imidazole.
| Compound Name | 2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-1H-imidazole |
|---|---|
| PubChem CID | 23218982 |
| Molecular Formula | C11H7F5N2O |
| Molecular Weight | 278.18 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]-1H-imidazole |
| SMILES | Fc1c(F)c(F)c(OCCc2ncc[nH]2)c(F)c1F |
| InChI | InChI=1S/C11H7F5N2O/c12-6-7(13)9(15)11(10(16)8(6)14)19-4-1-5-17-2-3-18-5/h2-3H,1,4H2,(H,17,18) |
| InChIKey | PLAKGVPGZPWOLU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.18 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|