About 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride
2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride (PubChem CID 67591450) has the molecular formula C12H13ClN2O2
and a molecular weight of 252.70 g/mol. Its IUPAC name is 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride |
| PubChem CID | 67591450 |
| Molecular Formula | C12H13ClN2O2 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride |
| SMILES | Cl.O=C(OCCc1ncc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C12H12N2O2.ClH/c15-12(10-4-2-1-3-5-10)16-9-6-11-13-7-8-14-11;/h1-5,7-8H,6,9H2,(H,13,14);1H |
| InChIKey | GCLXNFIDXNSQMW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride?
The IUPAC name of 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride (CID 67591450) is 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride.
What is the SMILES notation for 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride?
The canonical SMILES for 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride is Cl.O=C(OCCc1ncc[nH]1)c1ccccc1.
What is the InChIKey of 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride?
The InChIKey is GCLXNFIDXNSQMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2.ClH/c15-12(10-4-2-1-3-5-10)16-9-6-11-13-7-8-14-11;/h1-5,7-8H,6,9H2,(H,13,14);1H.
What are the key properties of 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride?
2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride has a molecular weight of 252.70 g/mol, XLogP of 2.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-2-yl)ethyl benzoate;hydrochloride is sourced from PubChem (CID 67591450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).