About N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide
N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide (PubChem CID 2322463) has the molecular formula C23H20N2O
and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide.
Molecular Properties
| Compound Name | N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide |
| PubChem CID | 2322463 |
| Molecular Formula | C23H20N2O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide |
| SMILES | Cc1ccc(N2Cc3ccccc3/C2=N\C(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C23H20N2O/c1-16-12-13-20(14-17(16)2)25-15-19-10-6-7-11-21(19)22(25)24-23(26)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3/b24-22+ |
| InChIKey | ZQWOBLMCAIZRKK-ZNTNEXAZSA-N |
| XLogP | 4.91 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide?
The IUPAC name of N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide (CID 2322463) is N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide.
What is the SMILES notation for N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide?
The canonical SMILES for N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide is Cc1ccc(N2Cc3ccccc3/C2=N\C(=O)c2ccccc2)cc1C.
What is the InChIKey of N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide?
The InChIKey is ZQWOBLMCAIZRKK-ZNTNEXAZSA-N. The full InChI is InChI=1S/C23H20N2O/c1-16-12-13-20(14-17(16)2)25-15-19-10-6-7-11-21(19)22(25)24-23(26)18-8-4-3-5-9-18/h3-14H,15H2,1-2H3/b24-22+.
What are the key properties of N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide?
N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide has a molecular weight of 340.43 g/mol, XLogP of 4.91, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dimethylphenyl)-3H-isoindol-1-ylidene]benzamide is sourced from PubChem (CID 2322463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).