C33H29F3N4O3S — CID 3621079
4-methyl-N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3H-isoindol-1-ylidene]benzamide (PubChem CID 3621079) has the molecular formula C33H29F3N4O3S and a molecular weight of 618.68 g/mol. Its IUPAC name is 4-methyl-N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3H-isoindol-1-ylidene]benzamide.
| Compound Name | 4-methyl-N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3H-isoindol-1-ylidene]benzamide |
|---|---|
| PubChem CID | 3621079 |
| Molecular Formula | C33H29F3N4O3S |
| Molecular Weight | 618.68 g/mol |
| Exact Mass | 618.19 |
| IUPAC Name | 4-methyl-N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]-3H-isoindol-1-ylidene]benzamide |
| SMILES | Cc1ccc(C(=O)/N=C2\c3ccccc3CN2c2ccc(N3CCCC3)c(S(=O)(=O)Nc3cccc(C(F)(F)F)c3)c2)cc1 |
| InChI | InChI=1S/C33H29F3N4O3S/c1-22-11-13-23(14-12-22)32(41)37-31-28-10-3-2-7-24(28)21-40(31)27-15-16-29(39-17-4-5-18-39)30(20-27)44(42,43)38-26-9-6-8-25(19-26)33(34,35)36/h2-3,6-16,19-20,38H,4-5,17-18,21H2,1H3/b37-31+ |
| InChIKey | WWSKTQGVHAPLOK-USLOJTSYSA-N |
| XLogP | 7.02 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.68 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|