C30H25F3N4O4S — CID 5115546
N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]isoindol-1-yl]furan-2-carboxamide (PubChem CID 5115546) has the molecular formula C30H25F3N4O4S and a molecular weight of 594.62 g/mol. Its IUPAC name is N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]isoindol-1-yl]furan-2-carboxamide.
| Compound Name | N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]isoindol-1-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 5115546 |
| Molecular Formula | C30H25F3N4O4S |
| Molecular Weight | 594.62 g/mol |
| Exact Mass | 594.15 |
| IUPAC Name | N-[2-[4-pyrrolidin-1-yl-3-[[3-(trifluoromethyl)phenyl]sulfamoyl]phenyl]isoindol-1-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1c2ccccc2cn1-c1ccc(N2CCCC2)c(S(=O)(=O)Nc2cccc(C(F)(F)F)c2)c1)c1ccco1 |
| InChI | InChI=1S/C30H25F3N4O4S/c31-30(32,33)21-8-5-9-22(17-21)35-42(39,40)27-18-23(12-13-25(27)36-14-3-4-15-36)37-19-20-7-1-2-10-24(20)28(37)34-29(38)26-11-6-16-41-26/h1-2,5-13,16-19,35H,3-4,14-15H2,(H,34,38) |
| InChIKey | FHCJYDRLIFRBDF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|